C20H29N4+ — CID 145155353
4-[4-[1-(3-aminopropyl)pyridin-1-ium-4-yl]butylideneamino]-N,N-dimethylaniline (PubChem CID 145155353) has the molecular formula C20H29N4+ and a molecular weight of 325.48 g/mol. Its IUPAC name is 4-[4-[1-(3-aminopropyl)pyridin-1-ium-4-yl]butylideneamino]-N,N-dimethylaniline.
| Compound Name | 4-[4-[1-(3-aminopropyl)pyridin-1-ium-4-yl]butylideneamino]-N,N-dimethylaniline |
|---|---|
| PubChem CID | 145155353 |
| Molecular Formula | C20H29N4+ |
| Molecular Weight | 325.48 g/mol |
| Exact Mass | 325.24 |
| IUPAC Name | 4-[4-[1-(3-aminopropyl)pyridin-1-ium-4-yl]butylideneamino]-N,N-dimethylaniline |
| SMILES | CN(C)c1ccc(/N=C/CCCc2cc[n+](CCCN)cc2)cc1 |
| InChI | InChI=1S/C20H29N4/c1-23(2)20-9-7-19(8-10-20)22-14-4-3-6-18-11-16-24(17-12-18)15-5-13-21/h7-12,14,16-17H,3-6,13,15,21H2,1-2H3/q+1/b22-14+ |
| InChIKey | UTJFSUFGNREQQW-HYARGMPZSA-N |
| XLogP | 3.11 |
| TPSA | 45.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.48 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|