C19H24N2 — CID 71281782
4-(4-benzyliminobutyl)-N,N-dimethylaniline (PubChem CID 71281782) has the molecular formula C19H24N2 and a molecular weight of 280.41 g/mol. Its IUPAC name is 4-(4-benzyliminobutyl)-N,N-dimethylaniline.
| Compound Name | 4-(4-benzyliminobutyl)-N,N-dimethylaniline |
|---|---|
| PubChem CID | 71281782 |
| Molecular Formula | C19H24N2 |
| Molecular Weight | 280.41 g/mol |
| Exact Mass | 280.19 |
| IUPAC Name | 4-(4-benzyliminobutyl)-N,N-dimethylaniline |
| SMILES | CN(C)c1ccc(CCC/C=N/Cc2ccccc2)cc1 |
| InChI | InChI=1S/C19H24N2/c1-21(2)19-13-11-17(12-14-19)8-6-7-15-20-16-18-9-4-3-5-10-18/h3-5,9-15H,6-8,16H2,1-2H3/b20-15+ |
| InChIKey | UHFTWTDVZUXVOS-HMMYKYKNSA-N |
| XLogP | 4.35 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.41 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|