C13H20N2 — CID 87880589
4-(5-iminopentyl)-N,N-dimethylaniline (PubChem CID 87880589) has the molecular formula C13H20N2 and a molecular weight of 204.32 g/mol. Its IUPAC name is 4-(5-iminopentyl)-N,N-dimethylaniline.
| Compound Name | 4-(5-iminopentyl)-N,N-dimethylaniline |
|---|---|
| PubChem CID | 87880589 |
| Molecular Formula | C13H20N2 |
| Molecular Weight | 204.32 g/mol |
| Exact Mass | 204.16 |
| IUPAC Name | 4-(5-iminopentyl)-N,N-dimethylaniline |
| SMILES | [H]/N=C/CCCCc1ccc(N(C)C)cc1 |
| InChI | InChI=1S/C13H20N2/c1-15(2)13-9-7-12(8-10-13)6-4-3-5-11-14/h7-11,14H,3-6H2,1-2H3/b14-11+ |
| InChIKey | QXQYCNXNTYQIJD-SDNWHVSQSA-N |
| XLogP | 3.11 |
| TPSA | 27.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.32 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|