C12H19NSi — CID 123895960
N,N-dimethyl-4-(3-methylsilylidenepropyl)aniline (PubChem CID 123895960) has the molecular formula C12H19NSi and a molecular weight of 205.38 g/mol. Its IUPAC name is N,N-dimethyl-4-(3-methylsilylidenepropyl)aniline.
| Compound Name | N,N-dimethyl-4-(3-methylsilylidenepropyl)aniline |
|---|---|
| PubChem CID | 123895960 |
| Molecular Formula | C12H19NSi |
| Molecular Weight | 205.38 g/mol |
| Exact Mass | 205.13 |
| IUPAC Name | N,N-dimethyl-4-(3-methylsilylidenepropyl)aniline |
| SMILES | C[SiH]=CCCc1ccc(N(C)C)cc1 |
| InChI | InChI=1S/C12H19NSi/c1-13(2)12-8-6-11(7-9-12)5-4-10-14-3/h6-10,14H,4-5H2,1-3H3 |
| InChIKey | GMAZOTQKACPGLR-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.38 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|