C14H20IN — CID 54112436
4-(6-iodohex-3-enyl)-N,N-dimethylaniline (PubChem CID 54112436) has the molecular formula C14H20IN and a molecular weight of 329.23 g/mol. Its IUPAC name is 4-(6-iodohex-3-enyl)-N,N-dimethylaniline.
| Compound Name | 4-(6-iodohex-3-enyl)-N,N-dimethylaniline |
|---|---|
| PubChem CID | 54112436 |
| Molecular Formula | C14H20IN |
| Molecular Weight | 329.23 g/mol |
| Exact Mass | 329.06 |
| IUPAC Name | 4-(6-iodohex-3-enyl)-N,N-dimethylaniline |
| SMILES | CN(C)c1ccc(CCC=CCCI)cc1 |
| InChI | InChI=1S/C14H20IN/c1-16(2)14-10-8-13(9-11-14)7-5-3-4-6-12-15/h3-4,8-11H,5-7,12H2,1-2H3 |
| InChIKey | NIAPFVYPZDOZEQ-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.23 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|