C12H19Cl2NSi — CID 54277336
4-[3-[dichloro(methyl)silyl]propyl]-N,N-dimethylaniline (PubChem CID 54277336) has the molecular formula C12H19Cl2NSi and a molecular weight of 276.28 g/mol. Its IUPAC name is 4-[3-[dichloro(methyl)silyl]propyl]-N,N-dimethylaniline.
| Compound Name | 4-[3-[dichloro(methyl)silyl]propyl]-N,N-dimethylaniline |
|---|---|
| PubChem CID | 54277336 |
| Molecular Formula | C12H19Cl2NSi |
| Molecular Weight | 276.28 g/mol |
| Exact Mass | 275.07 |
| IUPAC Name | 4-[3-[dichloro(methyl)silyl]propyl]-N,N-dimethylaniline |
| SMILES | CN(C)c1ccc(CCC[Si](C)(Cl)Cl)cc1 |
| InChI | InChI=1S/C12H19Cl2NSi/c1-15(2)12-8-6-11(7-9-12)5-4-10-16(3,13)14/h6-9H,4-5,10H2,1-3H3 |
| InChIKey | ROHXIHLTKFZDNS-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.28 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|