C17H21NO4S — CID 11772011
methyl (2S)-4-methylsulfanyl-2-[phenylmethoxycarbonyl(prop-2-ynyl)amino]butanoate (PubChem CID 11772011) has the molecular formula C17H21NO4S and a molecular weight of 335.42 g/mol. Its IUPAC name is methyl (2S)-4-methylsulfanyl-2-[phenylmethoxycarbonyl(prop-2-ynyl)amino]butanoate.
| Compound Name | methyl (2S)-4-methylsulfanyl-2-[phenylmethoxycarbonyl(prop-2-ynyl)amino]butanoate |
|---|---|
| PubChem CID | 11772011 |
| Molecular Formula | C17H21NO4S |
| Molecular Weight | 335.42 g/mol |
| Exact Mass | 335.12 |
| IUPAC Name | methyl (2S)-4-methylsulfanyl-2-[phenylmethoxycarbonyl(prop-2-ynyl)amino]butanoate |
| SMILES | C#CCN(C(=O)OCc1ccccc1)[C@@H](CCSC)C(=O)OC |
| InChI | InChI=1S/C17H21NO4S/c1-4-11-18(15(10-12-23-3)16(19)21-2)17(20)22-13-14-8-6-5-7-9-14/h1,5-9,15H,10-13H2,2-3H3/t15-/m0/s1 |
| InChIKey | QYXISOGBIFWDSS-HNNXBMFYSA-N |
| XLogP | 2.55 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.42 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|