C25H31NO7 — CID 162417631
methyl 2-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-4-naphthalen-2-yl-4-oxobutanoate (PubChem CID 162417631) has the molecular formula C25H31NO7 and a molecular weight of 457.52 g/mol. Its IUPAC name is methyl 2-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-4-naphthalen-2-yl-4-oxobutanoate.
| Compound Name | methyl 2-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-4-naphthalen-2-yl-4-oxobutanoate |
|---|---|
| PubChem CID | 162417631 |
| Molecular Formula | C25H31NO7 |
| Molecular Weight | 457.52 g/mol |
| Exact Mass | 457.21 |
| IUPAC Name | methyl 2-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-4-naphthalen-2-yl-4-oxobutanoate |
| SMILES | COC(=O)C(CC(=O)c1ccc2ccccc2c1)N(C(=O)OC(C)(C)C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C25H31NO7/c1-24(2,3)32-22(29)26(23(30)33-25(4,5)6)19(21(28)31-7)15-20(27)18-13-12-16-10-8-9-11-17(16)14-18/h8-14,19H,15H2,1-7H3 |
| InChIKey | JWXBIZQDXJMFPT-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 99.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.52 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|