C17H24N2O4 — CID 58047471
tert-butyl 4-(5-acetyl-2-aminoanilino)-3-methyl-4-oxobutanoate (PubChem CID 58047471) has the molecular formula C17H24N2O4 and a molecular weight of 320.39 g/mol. Its IUPAC name is tert-butyl 4-(5-acetyl-2-aminoanilino)-3-methyl-4-oxobutanoate.
| Compound Name | tert-butyl 4-(5-acetyl-2-aminoanilino)-3-methyl-4-oxobutanoate |
|---|---|
| PubChem CID | 58047471 |
| Molecular Formula | C17H24N2O4 |
| Molecular Weight | 320.39 g/mol |
| Exact Mass | 320.17 |
| IUPAC Name | tert-butyl 4-(5-acetyl-2-aminoanilino)-3-methyl-4-oxobutanoate |
| SMILES | CC(=O)c1ccc(N)c(NC(=O)C(C)CC(=O)OC(C)(C)C)c1 |
| InChI | InChI=1S/C17H24N2O4/c1-10(8-15(21)23-17(3,4)5)16(22)19-14-9-12(11(2)20)6-7-13(14)18/h6-7,9-10H,8,18H2,1-5H3,(H,19,22) |
| InChIKey | LLEFPCYVNNXJCX-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.39 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|