C19H31N3O4S2 — CID 138457839
tert-butyl N-[2-[[4-(2-aminoethyldisulfanyl)phenyl]methoxycarbonyl-methylamino]ethyl]-N-methylcarbamate (PubChem CID 138457839) has the molecular formula C19H31N3O4S2 and a molecular weight of 429.61 g/mol. Its IUPAC name is tert-butyl N-[2-[[4-(2-aminoethyldisulfanyl)phenyl]methoxycarbonyl-methylamino]ethyl]-N-methylcarbamate.
| Compound Name | tert-butyl N-[2-[[4-(2-aminoethyldisulfanyl)phenyl]methoxycarbonyl-methylamino]ethyl]-N-methylcarbamate |
|---|---|
| PubChem CID | 138457839 |
| Molecular Formula | C19H31N3O4S2 |
| Molecular Weight | 429.61 g/mol |
| Exact Mass | 429.18 |
| IUPAC Name | tert-butyl N-[2-[[4-(2-aminoethyldisulfanyl)phenyl]methoxycarbonyl-methylamino]ethyl]-N-methylcarbamate |
| SMILES | CN(CCN(C)C(=O)OC(C)(C)C)C(=O)OCc1ccc(SSCCN)cc1 |
| InChI | InChI=1S/C19H31N3O4S2/c1-19(2,3)26-18(24)22(5)12-11-21(4)17(23)25-14-15-6-8-16(9-7-15)28-27-13-10-20/h6-9H,10-14,20H2,1-5H3 |
| InChIKey | FEJMGLRVAGKUCB-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 85.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.61 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|