C22H34N2O4 — CID 163823018
tert-butyl N-methyl-N-[2-[methyl-[(2S)-2-methyl-4-phenylmethoxypent-4-enoyl]amino]ethyl]carbamate (PubChem CID 163823018) has the molecular formula C22H34N2O4 and a molecular weight of 390.52 g/mol. Its IUPAC name is tert-butyl N-methyl-N-[2-[methyl-[(2S)-2-methyl-4-phenylmethoxypent-4-enoyl]amino]ethyl]carbamate.
| Compound Name | tert-butyl N-methyl-N-[2-[methyl-[(2S)-2-methyl-4-phenylmethoxypent-4-enoyl]amino]ethyl]carbamate |
|---|---|
| PubChem CID | 163823018 |
| Molecular Formula | C22H34N2O4 |
| Molecular Weight | 390.52 g/mol |
| Exact Mass | 390.25 |
| IUPAC Name | tert-butyl N-methyl-N-[2-[methyl-[(2S)-2-methyl-4-phenylmethoxypent-4-enoyl]amino]ethyl]carbamate |
| SMILES | C=C(C[C@H](C)C(=O)N(C)CCN(C)C(=O)OC(C)(C)C)OCc1ccccc1 |
| InChI | InChI=1S/C22H34N2O4/c1-17(15-18(2)27-16-19-11-9-8-10-12-19)20(25)23(6)13-14-24(7)21(26)28-22(3,4)5/h8-12,17H,2,13-16H2,1,3-7H3/t17-/m0/s1 |
| InChIKey | NXAOXVSOBCQNHY-KRWDZBQOSA-N |
| XLogP | 4.07 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.52 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|