C33H40N4O9 — CID 70457573
4-[2-[4-[[3-(2-cyanophenoxy)-2-hydroxypropyl]amino]butoxy]-5-nitrophenyl]-1,4-diethyl-2,6-dimethylpyridine-3,5-dicarboxylic acid (PubChem CID 70457573) has the molecular formula C33H40N4O9 and a molecular weight of 636.70 g/mol. Its IUPAC name is 4-[2-[4-[[3-(2-cyanophenoxy)-2-hydroxypropyl]amino]butoxy]-5-nitrophenyl]-1,4-diethyl-2,6-dimethylpyridine-3,5-dicarboxylic acid.
| Compound Name | 4-[2-[4-[[3-(2-cyanophenoxy)-2-hydroxypropyl]amino]butoxy]-5-nitrophenyl]-1,4-diethyl-2,6-dimethylpyridine-3,5-dicarboxylic acid |
|---|---|
| PubChem CID | 70457573 |
| Molecular Formula | C33H40N4O9 |
| Molecular Weight | 636.70 g/mol |
| Exact Mass | 636.28 |
| IUPAC Name | 4-[2-[4-[[3-(2-cyanophenoxy)-2-hydroxypropyl]amino]butoxy]-5-nitrophenyl]-1,4-diethyl-2,6-dimethylpyridine-3,5-dicarboxylic acid |
| SMILES | CCN1C(C)=C(C(=O)O)C(CC)(c2cc([N+](=O)[O-])ccc2OCCCCNCC(O)COc2ccccc2C#N)C(C(=O)O)=C1C |
| InChI | InChI=1S/C33H40N4O9/c1-5-33(29(31(39)40)21(3)36(6-2)22(4)30(33)32(41)42)26-17-24(37(43)44)13-14-28(26)45-16-10-9-15-35-19-25(38)20-46-27-12-8-7-11-23(27)18-34/h7-8,11-14,17,25,35,38H,5-6,9-10,15-16,19-20H2,1-4H3,(H,39,40)(H,41,42) |
| InChIKey | MRPRWMWGVGBHNL-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 195.49 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.70 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|