C30H37N3O9 — CID 54326031
dimethyl 4-[2-[4-[(2-hydroxy-3-phenoxypropyl)amino]butoxy]-4-nitrophenyl]-2,6-dimethyl-3,4-dihydropyridine-3,5-dicarboxylate (PubChem CID 54326031) has the molecular formula C30H37N3O9 and a molecular weight of 583.64 g/mol. Its IUPAC name is dimethyl 4-[2-[4-[(2-hydroxy-3-phenoxypropyl)amino]butoxy]-4-nitrophenyl]-2,6-dimethyl-3,4-dihydropyridine-3,5-dicarboxylate.
| Compound Name | dimethyl 4-[2-[4-[(2-hydroxy-3-phenoxypropyl)amino]butoxy]-4-nitrophenyl]-2,6-dimethyl-3,4-dihydropyridine-3,5-dicarboxylate |
|---|---|
| PubChem CID | 54326031 |
| Molecular Formula | C30H37N3O9 |
| Molecular Weight | 583.64 g/mol |
| Exact Mass | 583.25 |
| IUPAC Name | dimethyl 4-[2-[4-[(2-hydroxy-3-phenoxypropyl)amino]butoxy]-4-nitrophenyl]-2,6-dimethyl-3,4-dihydropyridine-3,5-dicarboxylate |
| SMILES | COC(=O)C1=C(C)N=C(C)C(C(=O)OC)C1c1ccc([N+](=O)[O-])cc1OCCCCNCC(O)COc1ccccc1 |
| InChI | InChI=1S/C30H37N3O9/c1-19-26(29(35)39-3)28(27(20(2)32-19)30(36)40-4)24-13-12-21(33(37)38)16-25(24)41-15-9-8-14-31-17-22(34)18-42-23-10-6-5-7-11-23/h5-7,10-13,16,22,26,28,31,34H,8-9,14-15,17-18H2,1-4H3 |
| InChIKey | SUZQBKWULGZHDD-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 158.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.64 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|