C34H45N3O9 — CID 54164736
dipropan-2-yl 4-[2-[4-[(2-hydroxy-3-phenoxypropyl)amino]butoxy]-5-nitrophenyl]-2,6-dimethyl-3,4-dihydropyridine-3,5-dicarboxylate (PubChem CID 54164736) has the molecular formula C34H45N3O9 and a molecular weight of 639.75 g/mol. Its IUPAC name is dipropan-2-yl 4-[2-[4-[(2-hydroxy-3-phenoxypropyl)amino]butoxy]-5-nitrophenyl]-2,6-dimethyl-3,4-dihydropyridine-3,5-dicarboxylate.
| Compound Name | dipropan-2-yl 4-[2-[4-[(2-hydroxy-3-phenoxypropyl)amino]butoxy]-5-nitrophenyl]-2,6-dimethyl-3,4-dihydropyridine-3,5-dicarboxylate |
|---|---|
| PubChem CID | 54164736 |
| Molecular Formula | C34H45N3O9 |
| Molecular Weight | 639.75 g/mol |
| Exact Mass | 639.32 |
| IUPAC Name | dipropan-2-yl 4-[2-[4-[(2-hydroxy-3-phenoxypropyl)amino]butoxy]-5-nitrophenyl]-2,6-dimethyl-3,4-dihydropyridine-3,5-dicarboxylate |
| SMILES | CC1=NC(C)=C(C(=O)OC(C)C)C(c2cc([N+](=O)[O-])ccc2OCCCCNCC(O)COc2ccccc2)C1C(=O)OC(C)C |
| InChI | InChI=1S/C34H45N3O9/c1-21(2)45-33(39)30-23(5)36-24(6)31(34(40)46-22(3)4)32(30)28-18-25(37(41)42)14-15-29(28)43-17-11-10-16-35-19-26(38)20-44-27-12-8-7-9-13-27/h7-9,12-15,18,21-22,26,30,32,35,38H,10-11,16-17,19-20H2,1-6H3 |
| InChIKey | OQVSYCLTMLTVRE-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 158.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 46 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 639.75 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|