C33H40F3N3O9 — CID 154298296
5-O-ethyl 3-O-propan-2-yl 4-[5-[4-[(2-hydroxy-3-phenoxypropyl)amino]butoxy]-2-nitrophenyl]-2-methyl-6-(trifluoromethyl)-1,4-dihydropyridine-3,5-dicarboxylate (PubChem CID 154298296) has the molecular formula C33H40F3N3O9 and a molecular weight of 679.69 g/mol. Its IUPAC name is 5-O-ethyl 3-O-propan-2-yl 4-[5-[4-[(2-hydroxy-3-phenoxypropyl)amino]butoxy]-2-nitrophenyl]-2-methyl-6-(trifluoromethyl)-1,4-dihydropyridine-3,5-dicarboxylate.
| Compound Name | 5-O-ethyl 3-O-propan-2-yl 4-[5-[4-[(2-hydroxy-3-phenoxypropyl)amino]butoxy]-2-nitrophenyl]-2-methyl-6-(trifluoromethyl)-1,4-dihydropyridine-3,5-dicarboxylate |
|---|---|
| PubChem CID | 154298296 |
| Molecular Formula | C33H40F3N3O9 |
| Molecular Weight | 679.69 g/mol |
| Exact Mass | 679.27 |
| IUPAC Name | 5-O-ethyl 3-O-propan-2-yl 4-[5-[4-[(2-hydroxy-3-phenoxypropyl)amino]butoxy]-2-nitrophenyl]-2-methyl-6-(trifluoromethyl)-1,4-dihydropyridine-3,5-dicarboxylate |
| SMILES | CCOC(=O)C1=C(C(F)(F)F)NC(C)=C(C(=O)OC(C)C)C1c1cc(OCCCCNCC(O)COc2ccccc2)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C33H40F3N3O9/c1-5-45-31(41)29-28(27(32(42)48-20(2)3)21(4)38-30(29)33(34,35)36)25-17-24(13-14-26(25)39(43)44)46-16-10-9-15-37-18-22(40)19-47-23-11-7-6-8-12-23/h6-8,11-14,17,20,22,28,37-38,40H,5,9-10,15-16,18-19H2,1-4H3 |
| InChIKey | YMSZRYJOCLKXQB-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 158.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 48 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 679.69 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|