C33H43ClN4O11 — CID 139662819
dimethyl 2-[2-[4-[(2-hydroxy-3-phenoxypropyl)amino]butoxycarbonylamino]ethoxymethyl]-6-methyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate;hydrochloride (PubChem CID 139662819) has the molecular formula C33H43ClN4O11 and a molecular weight of 707.18 g/mol. Its IUPAC name is dimethyl 2-[2-[4-[(2-hydroxy-3-phenoxypropyl)amino]butoxycarbonylamino]ethoxymethyl]-6-methyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate;hydrochloride.
| Compound Name | dimethyl 2-[2-[4-[(2-hydroxy-3-phenoxypropyl)amino]butoxycarbonylamino]ethoxymethyl]-6-methyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate;hydrochloride |
|---|---|
| PubChem CID | 139662819 |
| Molecular Formula | C33H43ClN4O11 |
| Molecular Weight | 707.18 g/mol |
| Exact Mass | 706.26 |
| IUPAC Name | dimethyl 2-[2-[4-[(2-hydroxy-3-phenoxypropyl)amino]butoxycarbonylamino]ethoxymethyl]-6-methyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate;hydrochloride |
| SMILES | COC(=O)C1=C(C)NC(COCCNC(=O)OCCCCNCC(O)COc2ccccc2)=C(C(=O)OC)C1c1cccc([N+](=O)[O-])c1.Cl |
| InChI | InChI=1S/C33H42N4O11.ClH/c1-22-28(31(39)44-2)29(23-10-9-11-24(18-23)37(42)43)30(32(40)45-3)27(36-22)21-46-17-15-35-33(41)47-16-8-7-14-34-19-25(38)20-48-26-12-5-4-6-13-26;/h4-6,9-13,18,25,29,34,36,38H,7-8,14-17,19-21H2,1-3H3,(H,35,41);1H |
| InChIKey | WFTMWRUBEWQJTK-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 196.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 707.18 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|