C46H62N4O10 — CID 173370774
5-O-[10-[[2-hydroxy-3-(4-methylphenoxy)propyl]amino]-6-[(2-hydroxy-3-phenoxypropyl)amino]decyl] 3-O-methyl 1,2,6-trimethyl-4-(3-nitrophenyl)-4H-pyridine-3,5-dicarboxylate (PubChem CID 173370774) has the molecular formula C46H62N4O10 and a molecular weight of 831.02 g/mol. Its IUPAC name is 5-O-[10-[[2-hydroxy-3-(4-methylphenoxy)propyl]amino]-6-[(2-hydroxy-3-phenoxypropyl)amino]decyl] 3-O-methyl 1,2,6-trimethyl-4-(3-nitrophenyl)-4H-pyridine-3,5-dicarboxylate.
| Compound Name | 5-O-[10-[[2-hydroxy-3-(4-methylphenoxy)propyl]amino]-6-[(2-hydroxy-3-phenoxypropyl)amino]decyl] 3-O-methyl 1,2,6-trimethyl-4-(3-nitrophenyl)-4H-pyridine-3,5-dicarboxylate |
|---|---|
| PubChem CID | 173370774 |
| Molecular Formula | C46H62N4O10 |
| Molecular Weight | 831.02 g/mol |
| Exact Mass | 830.45 |
| IUPAC Name | 5-O-[10-[[2-hydroxy-3-(4-methylphenoxy)propyl]amino]-6-[(2-hydroxy-3-phenoxypropyl)amino]decyl] 3-O-methyl 1,2,6-trimethyl-4-(3-nitrophenyl)-4H-pyridine-3,5-dicarboxylate |
| SMILES | COC(=O)C1=C(C)N(C)C(C)=C(C(=O)OCCCCCC(CCCCNCC(O)COc2ccc(C)cc2)NCC(O)COc2ccccc2)C1c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C46H62N4O10/c1-32-21-23-41(24-22-32)60-30-38(51)28-47-25-12-11-17-36(48-29-39(52)31-59-40-19-9-6-10-20-40)16-8-7-13-26-58-46(54)43-34(3)49(4)33(2)42(45(53)57-5)44(43)35-15-14-18-37(27-35)50(55)56/h6,9-10,14-15,18-24,27,36,38-39,44,47-48,51-52H,7-8,11-13,16-17,25-26,28-31H2,1-5H3 |
| InChIKey | YGNGFNZVLVXXLD-UHFFFAOYSA-N |
| XLogP | 6.35 |
| TPSA | 181.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 60 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 831.02 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|