C40H50N4O7 — CID 14076001
5-O-[6-[2-[benzyl(1-phenoxypropan-2-yl)amino]ethylamino]hexyl] 3-O-methyl 2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate (PubChem CID 14076001) has the molecular formula C40H50N4O7 and a molecular weight of 698.86 g/mol. Its IUPAC name is 5-O-[6-[2-[benzyl(1-phenoxypropan-2-yl)amino]ethylamino]hexyl] 3-O-methyl 2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate.
| Compound Name | 5-O-[6-[2-[benzyl(1-phenoxypropan-2-yl)amino]ethylamino]hexyl] 3-O-methyl 2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate |
|---|---|
| PubChem CID | 14076001 |
| Molecular Formula | C40H50N4O7 |
| Molecular Weight | 698.86 g/mol |
| Exact Mass | 698.37 |
| IUPAC Name | 5-O-[6-[2-[benzyl(1-phenoxypropan-2-yl)amino]ethylamino]hexyl] 3-O-methyl 2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate |
| SMILES | COC(=O)C1=C(C)NC(C)=C(C(=O)OCCCCCCNCCN(Cc2ccccc2)C(C)COc2ccccc2)C1c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C40H50N4O7/c1-29(28-51-35-20-11-8-12-21-35)43(27-32-16-9-7-10-17-32)24-23-41-22-13-5-6-14-25-50-40(46)37-31(3)42-30(2)36(39(45)49-4)38(37)33-18-15-19-34(26-33)44(47)48/h7-12,15-21,26,29,38,41-42H,5-6,13-14,22-25,27-28H2,1-4H3 |
| InChIKey | HVXGDYOVHJBZFA-UHFFFAOYSA-N |
| XLogP | 6.67 |
| TPSA | 132.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 698.86 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|