C36H43N3O10 — CID 67579603
5-O-[2-[benzyl(methyl)amino]ethyl] 3-O-methyl 2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate;3-(2-methoxyphenoxy)propane-1,2-diol (PubChem CID 67579603) has the molecular formula C36H43N3O10 and a molecular weight of 677.75 g/mol. Its IUPAC name is 5-O-[2-[benzyl(methyl)amino]ethyl] 3-O-methyl 2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate;3-(2-methoxyphenoxy)propane-1,2-diol.
| Compound Name | 5-O-[2-[benzyl(methyl)amino]ethyl] 3-O-methyl 2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate;3-(2-methoxyphenoxy)propane-1,2-diol |
|---|---|
| PubChem CID | 67579603 |
| Molecular Formula | C36H43N3O10 |
| Molecular Weight | 677.75 g/mol |
| Exact Mass | 677.29 |
| IUPAC Name | 5-O-[2-[benzyl(methyl)amino]ethyl] 3-O-methyl 2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate;3-(2-methoxyphenoxy)propane-1,2-diol |
| SMILES | COC(=O)C1=C(C)NC(C)=C(C(=O)OCCN(C)Cc2ccccc2)C1c1cccc([N+](=O)[O-])c1.COc1ccccc1OCC(O)CO |
| InChI | InChI=1S/C26H29N3O6.C10H14O4/c1-17-22(25(30)34-4)24(20-11-8-12-21(15-20)29(32)33)23(18(2)27-17)26(31)35-14-13-28(3)16-19-9-6-5-7-10-19;1-13-9-4-2-3-5-10(9)14-7-8(12)6-11/h5-12,15,24,27H,13-14,16H2,1-4H3;2-5,8,11-12H,6-7H2,1H3 |
| InChIKey | AFDSRWWUNMCQPQ-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 169.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 677.75 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|