C31H39N3O8 — CID 70452263
5-O-(7-amino-8-hydroxy-9-phenoxynonyl) 3-O-methyl 2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate (PubChem CID 70452263) has the molecular formula C31H39N3O8 and a molecular weight of 581.67 g/mol. Its IUPAC name is 5-O-(7-amino-8-hydroxy-9-phenoxynonyl) 3-O-methyl 2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate.
| Compound Name | 5-O-(7-amino-8-hydroxy-9-phenoxynonyl) 3-O-methyl 2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate |
|---|---|
| PubChem CID | 70452263 |
| Molecular Formula | C31H39N3O8 |
| Molecular Weight | 581.67 g/mol |
| Exact Mass | 581.27 |
| IUPAC Name | 5-O-(7-amino-8-hydroxy-9-phenoxynonyl) 3-O-methyl 2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate |
| SMILES | COC(=O)C1=C(C)NC(C)=C(C(=O)OCCCCCCC(N)C(O)COc2ccccc2)C1c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C31H39N3O8/c1-20-27(30(36)40-3)29(22-12-11-13-23(18-22)34(38)39)28(21(2)33-20)31(37)41-17-10-5-4-9-16-25(32)26(35)19-42-24-14-7-6-8-15-24/h6-8,11-15,18,25-26,29,33,35H,4-5,9-10,16-17,19,32H2,1-3H3 |
| InChIKey | NQTCUBAGWBMBLC-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 163.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.67 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|