C31H38N2O9 — CID 22839219
3-O-methyl 5-O-[3-[4-[2-(propoxymethoxy)ethyl]phenoxy]propyl] (4S)-2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate (PubChem CID 22839219) has the molecular formula C31H38N2O9 and a molecular weight of 582.65 g/mol. Its IUPAC name is 3-O-methyl 5-O-[3-[4-[2-(propoxymethoxy)ethyl]phenoxy]propyl] (4S)-2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate.
| Compound Name | 3-O-methyl 5-O-[3-[4-[2-(propoxymethoxy)ethyl]phenoxy]propyl] (4S)-2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate |
|---|---|
| PubChem CID | 22839219 |
| Molecular Formula | C31H38N2O9 |
| Molecular Weight | 582.65 g/mol |
| Exact Mass | 582.26 |
| IUPAC Name | 3-O-methyl 5-O-[3-[4-[2-(propoxymethoxy)ethyl]phenoxy]propyl] (4S)-2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate |
| SMILES | CCCOCOCCc1ccc(OCCCOC(=O)C2=C(C)NC(C)=C(C(=O)OC)[C@@H]2c2cccc([N+](=O)[O-])c2)cc1 |
| InChI | InChI=1S/C31H38N2O9/c1-5-15-39-20-40-18-14-23-10-12-26(13-11-23)41-16-7-17-42-31(35)28-22(3)32-21(2)27(30(34)38-4)29(28)24-8-6-9-25(19-24)33(36)37/h6,8-13,19,29,32H,5,7,14-18,20H2,1-4H3/t29-/m0/s1 |
| InChIKey | USEYWIBMTKYFBX-LJAQVGFWSA-N |
| XLogP | 4.96 |
| TPSA | 135.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.65 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|