C30H34F3N3O8 — CID 139680744
3-O-[5-[(2-hydroxy-3-phenoxypropyl)amino]pentyl] 5-O-methyl 2-methyl-4-(3-nitrophenyl)-6-(trifluoromethyl)-1,4-dihydropyridine-3,5-dicarboxylate (PubChem CID 139680744) has the molecular formula C30H34F3N3O8 and a molecular weight of 621.61 g/mol. Its IUPAC name is 3-O-[5-[(2-hydroxy-3-phenoxypropyl)amino]pentyl] 5-O-methyl 2-methyl-4-(3-nitrophenyl)-6-(trifluoromethyl)-1,4-dihydropyridine-3,5-dicarboxylate.
| Compound Name | 3-O-[5-[(2-hydroxy-3-phenoxypropyl)amino]pentyl] 5-O-methyl 2-methyl-4-(3-nitrophenyl)-6-(trifluoromethyl)-1,4-dihydropyridine-3,5-dicarboxylate |
|---|---|
| PubChem CID | 139680744 |
| Molecular Formula | C30H34F3N3O8 |
| Molecular Weight | 621.61 g/mol |
| Exact Mass | 621.23 |
| IUPAC Name | 3-O-[5-[(2-hydroxy-3-phenoxypropyl)amino]pentyl] 5-O-methyl 2-methyl-4-(3-nitrophenyl)-6-(trifluoromethyl)-1,4-dihydropyridine-3,5-dicarboxylate |
| SMILES | COC(=O)C1=C(C(F)(F)F)NC(C)=C(C(=O)OCCCCCNCC(O)COc2ccccc2)C1c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C30H34F3N3O8/c1-19-24(29(39)43-15-8-4-7-14-34-17-22(37)18-44-23-12-5-3-6-13-23)25(20-10-9-11-21(16-20)36(40)41)26(28(38)42-2)27(35-19)30(31,32)33/h3,5-6,9-13,16,22,25,34-35,37H,4,7-8,14-15,17-18H2,1-2H3 |
| InChIKey | GVLXMMOBTPMMPH-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 149.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.61 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|