C33H44F3N3O9 — CID 57120487
5-ethyl-4-[2-[4-[(2-hydroxy-3-phenoxypropyl)amino]butoxy]-5-nitrophenyl]-2-methyl-3-propyl-6-(trifluoromethyl)piperidine-3,5-dicarboxylic acid (PubChem CID 57120487) has the molecular formula C33H44F3N3O9 and a molecular weight of 683.72 g/mol. Its IUPAC name is 5-ethyl-4-[2-[4-[(2-hydroxy-3-phenoxypropyl)amino]butoxy]-5-nitrophenyl]-2-methyl-3-propyl-6-(trifluoromethyl)piperidine-3,5-dicarboxylic acid.
| Compound Name | 5-ethyl-4-[2-[4-[(2-hydroxy-3-phenoxypropyl)amino]butoxy]-5-nitrophenyl]-2-methyl-3-propyl-6-(trifluoromethyl)piperidine-3,5-dicarboxylic acid |
|---|---|
| PubChem CID | 57120487 |
| Molecular Formula | C33H44F3N3O9 |
| Molecular Weight | 683.72 g/mol |
| Exact Mass | 683.30 |
| IUPAC Name | 5-ethyl-4-[2-[4-[(2-hydroxy-3-phenoxypropyl)amino]butoxy]-5-nitrophenyl]-2-methyl-3-propyl-6-(trifluoromethyl)piperidine-3,5-dicarboxylic acid |
| SMILES | CCCC1(C(=O)O)C(C)NC(C(F)(F)F)C(CC)(C(=O)O)C1c1cc([N+](=O)[O-])ccc1OCCCCNCC(O)COc1ccccc1 |
| InChI | InChI=1S/C33H44F3N3O9/c1-4-15-32(30(43)44)21(3)38-28(33(34,35)36)31(5-2,29(41)42)27(32)25-18-22(39(45)46)13-14-26(25)47-17-10-9-16-37-19-23(40)20-48-24-11-7-6-8-12-24/h6-8,11-14,18,21,23,27-28,37-38,40H,4-5,9-10,15-17,19-20H2,1-3H3,(H,41,42)(H,43,44) |
| InChIKey | ITKSLOXICRQZJS-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 180.49 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 683.72 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|