C31H36N4O9 — CID 54075382
5-O-[3-[4-[2-hydroxy-3-(propan-2-ylamino)propoxy]phenoxy]propyl] 3-O-methyl 2-cyano-6-methyl-4-(3-nitrophenyl)-3,4-dihydropyridine-3,5-dicarboxylate (PubChem CID 54075382) has the molecular formula C31H36N4O9 and a molecular weight of 608.65 g/mol. Its IUPAC name is 5-O-[3-[4-[2-hydroxy-3-(propan-2-ylamino)propoxy]phenoxy]propyl] 3-O-methyl 2-cyano-6-methyl-4-(3-nitrophenyl)-3,4-dihydropyridine-3,5-dicarboxylate.
| Compound Name | 5-O-[3-[4-[2-hydroxy-3-(propan-2-ylamino)propoxy]phenoxy]propyl] 3-O-methyl 2-cyano-6-methyl-4-(3-nitrophenyl)-3,4-dihydropyridine-3,5-dicarboxylate |
|---|---|
| PubChem CID | 54075382 |
| Molecular Formula | C31H36N4O9 |
| Molecular Weight | 608.65 g/mol |
| Exact Mass | 608.25 |
| IUPAC Name | 5-O-[3-[4-[2-hydroxy-3-(propan-2-ylamino)propoxy]phenoxy]propyl] 3-O-methyl 2-cyano-6-methyl-4-(3-nitrophenyl)-3,4-dihydropyridine-3,5-dicarboxylate |
| SMILES | COC(=O)C1C(C#N)=NC(C)=C(C(=O)OCCCOc2ccc(OCC(O)CNC(C)C)cc2)C1c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C31H36N4O9/c1-19(2)33-17-23(36)18-44-25-11-9-24(10-12-25)42-13-6-14-43-31(38)27-20(3)34-26(16-32)29(30(37)41-4)28(27)21-7-5-8-22(15-21)35(39)40/h5,7-12,15,19,23,28-29,33,36H,6,13-14,17-18H2,1-4H3 |
| InChIKey | MJHYORHWVIROSI-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 182.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.65 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|