C31H36F3N3O8 — CID 70056621
3-O-[3-[4-(1-amino-6-hydroxyhexoxy)phenyl]propyl] 5-O-methyl 2-methyl-4-(3-nitrophenyl)-6-(trifluoromethyl)-1,4-dihydropyridine-3,5-dicarboxylate (PubChem CID 70056621) has the molecular formula C31H36F3N3O8 and a molecular weight of 635.64 g/mol. Its IUPAC name is 3-O-[3-[4-(1-amino-6-hydroxyhexoxy)phenyl]propyl] 5-O-methyl 2-methyl-4-(3-nitrophenyl)-6-(trifluoromethyl)-1,4-dihydropyridine-3,5-dicarboxylate.
| Compound Name | 3-O-[3-[4-(1-amino-6-hydroxyhexoxy)phenyl]propyl] 5-O-methyl 2-methyl-4-(3-nitrophenyl)-6-(trifluoromethyl)-1,4-dihydropyridine-3,5-dicarboxylate |
|---|---|
| PubChem CID | 70056621 |
| Molecular Formula | C31H36F3N3O8 |
| Molecular Weight | 635.64 g/mol |
| Exact Mass | 635.25 |
| IUPAC Name | 3-O-[3-[4-(1-amino-6-hydroxyhexoxy)phenyl]propyl] 5-O-methyl 2-methyl-4-(3-nitrophenyl)-6-(trifluoromethyl)-1,4-dihydropyridine-3,5-dicarboxylate |
| SMILES | COC(=O)C1=C(C(F)(F)F)NC(C)=C(C(=O)OCCCc2ccc(OC(N)CCCCCO)cc2)C1c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C31H36F3N3O8/c1-19-25(30(40)44-17-7-8-20-12-14-23(15-13-20)45-24(35)11-4-3-5-16-38)26(21-9-6-10-22(18-21)37(41)42)27(29(39)43-2)28(36-19)31(32,33)34/h6,9-10,12-15,18,24,26,36,38H,3-5,7-8,11,16-17,35H2,1-2H3 |
| InChIKey | YRTAJZBYTWOZNG-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 163.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.64 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|