C29H32N4O8 — CID 19829381
methyl 6-[2-[[2-hydroxy-3-(2-methoxyphenoxy)propyl]amino]ethyl]-2-methyl-4-(3-nitrophenyl)-5-oxo-1,4-dihydro-1,6-naphthyridine-3-carboxylate (PubChem CID 19829381) has the molecular formula C29H32N4O8 and a molecular weight of 564.60 g/mol. Its IUPAC name is methyl 6-[2-[[2-hydroxy-3-(2-methoxyphenoxy)propyl]amino]ethyl]-2-methyl-4-(3-nitrophenyl)-5-oxo-1,4-dihydro-1,6-naphthyridine-3-carboxylate.
| Compound Name | methyl 6-[2-[[2-hydroxy-3-(2-methoxyphenoxy)propyl]amino]ethyl]-2-methyl-4-(3-nitrophenyl)-5-oxo-1,4-dihydro-1,6-naphthyridine-3-carboxylate |
|---|---|
| PubChem CID | 19829381 |
| Molecular Formula | C29H32N4O8 |
| Molecular Weight | 564.60 g/mol |
| Exact Mass | 564.22 |
| IUPAC Name | methyl 6-[2-[[2-hydroxy-3-(2-methoxyphenoxy)propyl]amino]ethyl]-2-methyl-4-(3-nitrophenyl)-5-oxo-1,4-dihydro-1,6-naphthyridine-3-carboxylate |
| SMILES | COC(=O)C1=C(C)Nc2ccn(CCNCC(O)COc3ccccc3OC)c(=O)c2C1c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C29H32N4O8/c1-18-25(29(36)40-3)26(19-7-6-8-20(15-19)33(37)38)27-22(31-18)11-13-32(28(27)35)14-12-30-16-21(34)17-41-24-10-5-4-9-23(24)39-2/h4-11,13,15,21,26,30-31,34H,12,14,16-17H2,1-3H3 |
| InChIKey | ZUIFJQPLIPYSSS-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 154.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.60 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|