C25H25N3O8 — CID 70085452
5-[2-(4-acetamidophenoxy)ethoxycarbonyl]-2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3-carboxylic acid (PubChem CID 70085452) has the molecular formula C25H25N3O8 and a molecular weight of 495.49 g/mol. Its IUPAC name is 5-[2-(4-acetamidophenoxy)ethoxycarbonyl]-2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3-carboxylic acid.
| Compound Name | 5-[2-(4-acetamidophenoxy)ethoxycarbonyl]-2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 70085452 |
| Molecular Formula | C25H25N3O8 |
| Molecular Weight | 495.49 g/mol |
| Exact Mass | 495.16 |
| IUPAC Name | 5-[2-(4-acetamidophenoxy)ethoxycarbonyl]-2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3-carboxylic acid |
| SMILES | CC(=O)Nc1ccc(OCCOC(=O)C2=C(C)NC(C)=C(C(=O)O)C2c2cccc([N+](=O)[O-])c2)cc1 |
| InChI | InChI=1S/C25H25N3O8/c1-14-21(24(30)31)23(17-5-4-6-19(13-17)28(33)34)22(15(2)26-14)25(32)36-12-11-35-20-9-7-18(8-10-20)27-16(3)29/h4-10,13,23,26H,11-12H2,1-3H3,(H,27,29)(H,30,31) |
| InChIKey | NXJUUNGWXJWPLQ-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 157.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.49 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|