C25H26N2O8 — CID 67808984
5-[2-(2,4-dimethoxyphenyl)ethoxycarbonyl]-2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3-carboxylic acid (PubChem CID 67808984) has the molecular formula C25H26N2O8 and a molecular weight of 482.49 g/mol. Its IUPAC name is 5-[2-(2,4-dimethoxyphenyl)ethoxycarbonyl]-2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3-carboxylic acid.
| Compound Name | 5-[2-(2,4-dimethoxyphenyl)ethoxycarbonyl]-2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 67808984 |
| Molecular Formula | C25H26N2O8 |
| Molecular Weight | 482.49 g/mol |
| Exact Mass | 482.17 |
| IUPAC Name | 5-[2-(2,4-dimethoxyphenyl)ethoxycarbonyl]-2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3-carboxylic acid |
| SMILES | COc1ccc(CCOC(=O)C2=C(C)NC(C)=C(C(=O)O)C2c2cccc([N+](=O)[O-])c2)c(OC)c1 |
| InChI | InChI=1S/C25H26N2O8/c1-14-21(24(28)29)23(17-6-5-7-18(12-17)27(31)32)22(15(2)26-14)25(30)35-11-10-16-8-9-19(33-3)13-20(16)34-4/h5-9,12-13,23,26H,10-11H2,1-4H3,(H,28,29) |
| InChIKey | OWHBVEBZNHGOFN-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 137.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.49 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|