C38H42N2O10 — CID 70466504
5-O-[2-[4-[2,2-dimethyl-5-(phenylmethoxymethyl)-1,3-dioxolan-4-yl]-2-methoxyphenyl]ethyl] 3-O-methyl 2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate (PubChem CID 70466504) has the molecular formula C38H42N2O10 and a molecular weight of 686.76 g/mol. Its IUPAC name is 5-O-[2-[4-[2,2-dimethyl-5-(phenylmethoxymethyl)-1,3-dioxolan-4-yl]-2-methoxyphenyl]ethyl] 3-O-methyl 2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate.
| Compound Name | 5-O-[2-[4-[2,2-dimethyl-5-(phenylmethoxymethyl)-1,3-dioxolan-4-yl]-2-methoxyphenyl]ethyl] 3-O-methyl 2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate |
|---|---|
| PubChem CID | 70466504 |
| Molecular Formula | C38H42N2O10 |
| Molecular Weight | 686.76 g/mol |
| Exact Mass | 686.28 |
| IUPAC Name | 5-O-[2-[4-[2,2-dimethyl-5-(phenylmethoxymethyl)-1,3-dioxolan-4-yl]-2-methoxyphenyl]ethyl] 3-O-methyl 2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate |
| SMILES | COC(=O)C1=C(C)NC(C)=C(C(=O)OCCc2ccc(C3OC(C)(C)OC3COCc3ccccc3)cc2OC)C1c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C38H42N2O10/c1-23-32(36(41)46-6)34(27-13-10-14-29(19-27)40(43)44)33(24(2)39-23)37(42)48-18-17-26-15-16-28(20-30(26)45-5)35-31(49-38(3,4)50-35)22-47-21-25-11-8-7-9-12-25/h7-16,19-20,31,34-35,39H,17-18,21-22H2,1-6H3 |
| InChIKey | NPERYCCVEACUJH-UHFFFAOYSA-N |
| XLogP | 6.21 |
| TPSA | 144.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 50 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 686.76 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|