C24H28N2O8 — CID 14748231
5-O-(1,4-dioxaspiro[4.4]nonan-3-ylmethyl) 3-O-methyl 2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate (PubChem CID 14748231) has the molecular formula C24H28N2O8 and a molecular weight of 472.49 g/mol. Its IUPAC name is 5-O-(1,4-dioxaspiro[4.4]nonan-3-ylmethyl) 3-O-methyl 2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate.
| Compound Name | 5-O-(1,4-dioxaspiro[4.4]nonan-3-ylmethyl) 3-O-methyl 2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate |
|---|---|
| PubChem CID | 14748231 |
| Molecular Formula | C24H28N2O8 |
| Molecular Weight | 472.49 g/mol |
| Exact Mass | 472.18 |
| IUPAC Name | 5-O-(1,4-dioxaspiro[4.4]nonan-3-ylmethyl) 3-O-methyl 2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate |
| SMILES | COC(=O)C1=C(C)NC(C)=C(C(=O)OCC2COC3(CCCC3)O2)C1c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C24H28N2O8/c1-14-19(22(27)31-3)21(16-7-6-8-17(11-16)26(29)30)20(15(2)25-14)23(28)32-12-18-13-33-24(34-18)9-4-5-10-24/h6-8,11,18,21,25H,4-5,9-10,12-13H2,1-3H3 |
| InChIKey | RZOFDSRAPFFUDV-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 126.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.49 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|