C47H42N2O10 — CID 70380577
bis[(2,2-diphenyl-1,3-dioxolan-4-yl)methyl] 2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate (PubChem CID 70380577) has the molecular formula C47H42N2O10 and a molecular weight of 794.86 g/mol. Its IUPAC name is bis[(2,2-diphenyl-1,3-dioxolan-4-yl)methyl] 2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate.
| Compound Name | bis[(2,2-diphenyl-1,3-dioxolan-4-yl)methyl] 2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate |
|---|---|
| PubChem CID | 70380577 |
| Molecular Formula | C47H42N2O10 |
| Molecular Weight | 794.86 g/mol |
| Exact Mass | 794.28 |
| IUPAC Name | bis[(2,2-diphenyl-1,3-dioxolan-4-yl)methyl] 2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate |
| SMILES | CC1=C(C(=O)OCC2COC(c3ccccc3)(c3ccccc3)O2)C(c2cccc([N+](=O)[O-])c2)C(C(=O)OCC2COC(c3ccccc3)(c3ccccc3)O2)=C(C)N1 |
| InChI | InChI=1S/C47H42N2O10/c1-31-41(44(50)54-27-39-29-56-46(58-39,34-17-7-3-8-18-34)35-19-9-4-10-20-35)43(33-16-15-25-38(26-33)49(52)53)42(32(2)48-31)45(51)55-28-40-30-57-47(59-40,36-21-11-5-12-22-36)37-23-13-6-14-24-37/h3-26,39-40,43,48H,27-30H2,1-2H3 |
| InChIKey | XJZUGDALWGNYRW-UHFFFAOYSA-N |
| XLogP | 7.55 |
| TPSA | 144.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 59 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 794.86 |
| LogP ≤ 5 | 7.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|