C27H34N2O10 — CID 14748232
bis[(2,2-dimethyl-1,3-dioxolan-4-yl)methyl] 2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate (PubChem CID 14748232) has the molecular formula C27H34N2O10 and a molecular weight of 546.57 g/mol. Its IUPAC name is bis[(2,2-dimethyl-1,3-dioxolan-4-yl)methyl] 2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate.
| Compound Name | bis[(2,2-dimethyl-1,3-dioxolan-4-yl)methyl] 2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate |
|---|---|
| PubChem CID | 14748232 |
| Molecular Formula | C27H34N2O10 |
| Molecular Weight | 546.57 g/mol |
| Exact Mass | 546.22 |
| IUPAC Name | bis[(2,2-dimethyl-1,3-dioxolan-4-yl)methyl] 2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate |
| SMILES | CC1=C(C(=O)OCC2COC(C)(C)O2)C(c2cccc([N+](=O)[O-])c2)C(C(=O)OCC2COC(C)(C)O2)=C(C)N1 |
| InChI | InChI=1S/C27H34N2O10/c1-15-21(24(30)34-11-19-13-36-26(3,4)38-19)23(17-8-7-9-18(10-17)29(32)33)22(16(2)28-15)25(31)35-12-20-14-37-27(5,6)39-20/h7-10,19-20,23,28H,11-14H2,1-6H3 |
| InChIKey | DKKYWWJENWSVFT-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 144.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.57 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|