C43H46Cl2N4O10 — CID 70386405
bis[[8-(4-chlorophenyl)-1,4-dioxa-8-azaspiro[4.5]decan-3-yl]methyl] 2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate (PubChem CID 70386405) has the molecular formula C43H46Cl2N4O10 and a molecular weight of 849.77 g/mol. Its IUPAC name is bis[[8-(4-chlorophenyl)-1,4-dioxa-8-azaspiro[4.5]decan-3-yl]methyl] 2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate.
| Compound Name | bis[[8-(4-chlorophenyl)-1,4-dioxa-8-azaspiro[4.5]decan-3-yl]methyl] 2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate |
|---|---|
| PubChem CID | 70386405 |
| Molecular Formula | C43H46Cl2N4O10 |
| Molecular Weight | 849.77 g/mol |
| Exact Mass | 848.26 |
| IUPAC Name | bis[[8-(4-chlorophenyl)-1,4-dioxa-8-azaspiro[4.5]decan-3-yl]methyl] 2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate |
| SMILES | CC1=C(C(=O)OCC2COC3(CCN(c4ccc(Cl)cc4)CC3)O2)C(c2cccc([N+](=O)[O-])c2)C(C(=O)OCC2COC3(CCN(c4ccc(Cl)cc4)CC3)O2)=C(C)N1 |
| InChI | InChI=1S/C43H46Cl2N4O10/c1-27-37(40(50)54-23-35-25-56-42(58-35)14-18-47(19-15-42)32-10-6-30(44)7-11-32)39(29-4-3-5-34(22-29)49(52)53)38(28(2)46-27)41(51)55-24-36-26-57-43(59-36)16-20-48(21-17-43)33-12-8-31(45)9-13-33/h3-13,22,35-36,39,46H,14-21,23-26H2,1-2H3 |
| InChIKey | LNTPKIVIRNSSKS-UHFFFAOYSA-N |
| XLogP | 7.05 |
| TPSA | 151.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 59 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 849.77 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|