C30H30N4O6 — CID 67842653
5-O-[3-[4-(imidazol-1-ylmethyl)phenyl]but-2-enyl] 3-O-methyl 2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate (PubChem CID 67842653) has the molecular formula C30H30N4O6 and a molecular weight of 542.59 g/mol. Its IUPAC name is 5-O-[3-[4-(imidazol-1-ylmethyl)phenyl]but-2-enyl] 3-O-methyl 2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate.
| Compound Name | 5-O-[3-[4-(imidazol-1-ylmethyl)phenyl]but-2-enyl] 3-O-methyl 2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate |
|---|---|
| PubChem CID | 67842653 |
| Molecular Formula | C30H30N4O6 |
| Molecular Weight | 542.59 g/mol |
| Exact Mass | 542.22 |
| IUPAC Name | 5-O-[3-[4-(imidazol-1-ylmethyl)phenyl]but-2-enyl] 3-O-methyl 2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate |
| SMILES | COC(=O)C1=C(C)NC(C)=C(C(=O)OCC=C(C)c2ccc(Cn3ccnc3)cc2)C1c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C30H30N4O6/c1-19(23-10-8-22(9-11-23)17-33-14-13-31-18-33)12-15-40-30(36)27-21(3)32-20(2)26(29(35)39-4)28(27)24-6-5-7-25(16-24)34(37)38/h5-14,16,18,28,32H,15,17H2,1-4H3 |
| InChIKey | XLPYMZWSKLXHAU-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 125.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.59 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|