C35H37N3O7 — CID 14052067
5-O-propan-2-yl 3-O-[2-[(E)-3-[4-(pyridin-3-ylmethyl)phenyl]prop-2-enoxy]ethyl] 2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate (PubChem CID 14052067) has the molecular formula C35H37N3O7 and a molecular weight of 611.70 g/mol. Its IUPAC name is 5-O-propan-2-yl 3-O-[2-[(E)-3-[4-(pyridin-3-ylmethyl)phenyl]prop-2-enoxy]ethyl] 2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate.
| Compound Name | 5-O-propan-2-yl 3-O-[2-[(E)-3-[4-(pyridin-3-ylmethyl)phenyl]prop-2-enoxy]ethyl] 2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate |
|---|---|
| PubChem CID | 14052067 |
| Molecular Formula | C35H37N3O7 |
| Molecular Weight | 611.70 g/mol |
| Exact Mass | 611.26 |
| IUPAC Name | 5-O-propan-2-yl 3-O-[2-[(E)-3-[4-(pyridin-3-ylmethyl)phenyl]prop-2-enoxy]ethyl] 2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate |
| SMILES | CC1=C(C(=O)OCCOC/C=C/c2ccc(Cc3cccnc3)cc2)C(c2cccc([N+](=O)[O-])c2)C(C(=O)OC(C)C)=C(C)N1 |
| InChI | InChI=1S/C35H37N3O7/c1-23(2)45-35(40)32-25(4)37-24(3)31(33(32)29-10-5-11-30(21-29)38(41)42)34(39)44-19-18-43-17-7-9-26-12-14-27(15-13-26)20-28-8-6-16-36-22-28/h5-16,21-23,33,37H,17-20H2,1-4H3/b9-7+ |
| InChIKey | GDBPHZYFCKTXAV-VQHVLOKHSA-N |
| XLogP | 6.04 |
| TPSA | 129.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.70 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|