C28H32N2O5 — CID 10528588
N-[3-[2,6-dimethyl-3,5-bis(propan-2-yloxycarbonyl)-1,4-dihydropyridin-4-yl]phenyl]-1-phenylmethanimine oxide (PubChem CID 10528588) has the molecular formula C28H32N2O5 and a molecular weight of 476.57 g/mol. Its IUPAC name is N-[3-[2,6-dimethyl-3,5-bis(propan-2-yloxycarbonyl)-1,4-dihydropyridin-4-yl]phenyl]-1-phenylmethanimine oxide.
| Compound Name | N-[3-[2,6-dimethyl-3,5-bis(propan-2-yloxycarbonyl)-1,4-dihydropyridin-4-yl]phenyl]-1-phenylmethanimine oxide |
|---|---|
| PubChem CID | 10528588 |
| Molecular Formula | C28H32N2O5 |
| Molecular Weight | 476.57 g/mol |
| Exact Mass | 476.23 |
| IUPAC Name | N-[3-[2,6-dimethyl-3,5-bis(propan-2-yloxycarbonyl)-1,4-dihydropyridin-4-yl]phenyl]-1-phenylmethanimine oxide |
| SMILES | CC1=C(C(=O)OC(C)C)C(c2cccc(/[N+]([O-])=C/c3ccccc3)c2)C(C(=O)OC(C)C)=C(C)N1 |
| InChI | InChI=1S/C28H32N2O5/c1-17(2)34-27(31)24-19(5)29-20(6)25(28(32)35-18(3)4)26(24)22-13-10-14-23(15-22)30(33)16-21-11-8-7-9-12-21/h7-18,26,29H,1-6H3/b30-16- |
| InChIKey | TVRQOVCLYUPLJR-UHBFCERESA-N |
| XLogP | 5.09 |
| TPSA | 90.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.57 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|