C25H32N2O9 — CID 54430113
5-O-(2,2-dimethylpropanoyloxymethyl) 3-O-methyl (4S)-1-(ethoxymethyl)-2,6-dimethyl-4-(3-nitrophenyl)-4H-pyridine-3,5-dicarboxylate (PubChem CID 54430113) has the molecular formula C25H32N2O9 and a molecular weight of 504.54 g/mol. Its IUPAC name is 5-O-(2,2-dimethylpropanoyloxymethyl) 3-O-methyl (4S)-1-(ethoxymethyl)-2,6-dimethyl-4-(3-nitrophenyl)-4H-pyridine-3,5-dicarboxylate.
| Compound Name | 5-O-(2,2-dimethylpropanoyloxymethyl) 3-O-methyl (4S)-1-(ethoxymethyl)-2,6-dimethyl-4-(3-nitrophenyl)-4H-pyridine-3,5-dicarboxylate |
|---|---|
| PubChem CID | 54430113 |
| Molecular Formula | C25H32N2O9 |
| Molecular Weight | 504.54 g/mol |
| Exact Mass | 504.21 |
| IUPAC Name | 5-O-(2,2-dimethylpropanoyloxymethyl) 3-O-methyl (4S)-1-(ethoxymethyl)-2,6-dimethyl-4-(3-nitrophenyl)-4H-pyridine-3,5-dicarboxylate |
| SMILES | CCOCN1C(C)=C(C(=O)OC)[C@H](c2cccc([N+](=O)[O-])c2)C(C(=O)OCOC(=O)C(C)(C)C)=C1C |
| InChI | InChI=1S/C25H32N2O9/c1-8-34-13-26-15(2)19(22(28)33-7)21(17-10-9-11-18(12-17)27(31)32)20(16(26)3)23(29)35-14-36-24(30)25(4,5)6/h9-12,21H,8,13-14H2,1-7H3/t21-/m0/s1 |
| InChIKey | WGWVXRBSKYFDTC-NRFANRHFSA-N |
| XLogP | 3.80 |
| TPSA | 134.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.54 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|