C23H28N4O9 — CID 13092131
3-O-methyl 5-O-(2-morpholin-4-ylethyl) 2-(carbamoyloxymethyl)-6-methyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate (PubChem CID 13092131) has the molecular formula C23H28N4O9 and a molecular weight of 504.50 g/mol. Its IUPAC name is 3-O-methyl 5-O-(2-morpholin-4-ylethyl) 2-(carbamoyloxymethyl)-6-methyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate.
| Compound Name | 3-O-methyl 5-O-(2-morpholin-4-ylethyl) 2-(carbamoyloxymethyl)-6-methyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate |
|---|---|
| PubChem CID | 13092131 |
| Molecular Formula | C23H28N4O9 |
| Molecular Weight | 504.50 g/mol |
| Exact Mass | 504.19 |
| IUPAC Name | 3-O-methyl 5-O-(2-morpholin-4-ylethyl) 2-(carbamoyloxymethyl)-6-methyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate |
| SMILES | COC(=O)C1=C(COC(N)=O)NC(C)=C(C(=O)OCCN2CCOCC2)C1c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C23H28N4O9/c1-14-18(22(29)35-11-8-26-6-9-34-10-7-26)19(15-4-3-5-16(12-15)27(31)32)20(21(28)33-2)17(25-14)13-36-23(24)30/h3-5,12,19,25H,6-11,13H2,1-2H3,(H2,24,30) |
| InChIKey | HJBVISZPNCSIQN-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 172.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.50 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|