C38H38Cl2N4O3 — CID 57038594
5-(2,3-dichlorophenyl)-6-[5-(4,4-diphenylpiperidin-1-yl)pentanoyl]-1,3,7-trimethylpyrido[2,3-d]pyrimidine-2,4-dione (PubChem CID 57038594) has the molecular formula C38H38Cl2N4O3 and a molecular weight of 669.65 g/mol. Its IUPAC name is 5-(2,3-dichlorophenyl)-6-[5-(4,4-diphenylpiperidin-1-yl)pentanoyl]-1,3,7-trimethylpyrido[2,3-d]pyrimidine-2,4-dione.
| Compound Name | 5-(2,3-dichlorophenyl)-6-[5-(4,4-diphenylpiperidin-1-yl)pentanoyl]-1,3,7-trimethylpyrido[2,3-d]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 57038594 |
| Molecular Formula | C38H38Cl2N4O3 |
| Molecular Weight | 669.65 g/mol |
| Exact Mass | 668.23 |
| IUPAC Name | 5-(2,3-dichlorophenyl)-6-[5-(4,4-diphenylpiperidin-1-yl)pentanoyl]-1,3,7-trimethylpyrido[2,3-d]pyrimidine-2,4-dione |
| SMILES | Cc1nc2c(c(-c3cccc(Cl)c3Cl)c1C(=O)CCCCN1CCC(c3ccccc3)(c3ccccc3)CC1)c(=O)n(C)c(=O)n2C |
| InChI | InChI=1S/C38H38Cl2N4O3/c1-25-31(32(28-17-12-18-29(39)34(28)40)33-35(41-25)42(2)37(47)43(3)36(33)46)30(45)19-10-11-22-44-23-20-38(21-24-44,26-13-6-4-7-14-26)27-15-8-5-9-16-27/h4-9,12-18H,10-11,19-24H2,1-3H3 |
| InChIKey | QPAFWOYHZACNBS-UHFFFAOYSA-N |
| XLogP | 7.35 |
| TPSA | 77.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 669.65 |
| LogP ≤ 5 | 7.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|