C26H34BrN3O6 — CID 57064763
[2-amino-5-(11-bromoundecanoyl)-6-methyl-4-(3-nitrophenyl)-3-pyridinyl] ethyl carbonate (PubChem CID 57064763) has the molecular formula C26H34BrN3O6 and a molecular weight of 564.48 g/mol. Its IUPAC name is [2-amino-5-(11-bromoundecanoyl)-6-methyl-4-(3-nitrophenyl)-3-pyridinyl] ethyl carbonate.
| Compound Name | [2-amino-5-(11-bromoundecanoyl)-6-methyl-4-(3-nitrophenyl)-3-pyridinyl] ethyl carbonate |
|---|---|
| PubChem CID | 57064763 |
| Molecular Formula | C26H34BrN3O6 |
| Molecular Weight | 564.48 g/mol |
| Exact Mass | 563.16 |
| IUPAC Name | [2-amino-5-(11-bromoundecanoyl)-6-methyl-4-(3-nitrophenyl)-3-pyridinyl] ethyl carbonate |
| SMILES | CCOC(=O)Oc1c(N)nc(C)c(C(=O)CCCCCCCCCCBr)c1-c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C26H34BrN3O6/c1-3-35-26(32)36-24-23(19-13-12-14-20(17-19)30(33)34)22(18(2)29-25(24)28)21(31)15-10-8-6-4-5-7-9-11-16-27/h12-14,17H,3-11,15-16H2,1-2H3,(H2,28,29) |
| InChIKey | CIHVMEYOLLNCGO-UHFFFAOYSA-N |
| XLogP | 7.17 |
| TPSA | 134.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.48 |
| LogP ≤ 5 | 7.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|