C33H41N5O8 — CID 67612422
5-O-[3-[4-[[3-(dimethylcarbamoyloxy)phenyl]methyl]piperazin-1-yl]propyl] 3-O-methyl 2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate (PubChem CID 67612422) has the molecular formula C33H41N5O8 and a molecular weight of 635.72 g/mol. Its IUPAC name is 5-O-[3-[4-[[3-(dimethylcarbamoyloxy)phenyl]methyl]piperazin-1-yl]propyl] 3-O-methyl 2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate.
| Compound Name | 5-O-[3-[4-[[3-(dimethylcarbamoyloxy)phenyl]methyl]piperazin-1-yl]propyl] 3-O-methyl 2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate |
|---|---|
| PubChem CID | 67612422 |
| Molecular Formula | C33H41N5O8 |
| Molecular Weight | 635.72 g/mol |
| Exact Mass | 635.30 |
| IUPAC Name | 5-O-[3-[4-[[3-(dimethylcarbamoyloxy)phenyl]methyl]piperazin-1-yl]propyl] 3-O-methyl 2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate |
| SMILES | COC(=O)C1=C(C)NC(C)=C(C(=O)OCCCN2CCN(Cc3cccc(OC(=O)N(C)C)c3)CC2)C1c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C33H41N5O8/c1-22-28(31(39)44-5)30(25-10-7-11-26(20-25)38(42)43)29(23(2)34-22)32(40)45-18-8-13-36-14-16-37(17-15-36)21-24-9-6-12-27(19-24)46-33(41)35(3)4/h6-7,9-12,19-20,30,34H,8,13-18,21H2,1-5H3 |
| InChIKey | OPIZGLTYQGJFEL-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 143.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.72 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|