C30H35Cl3N4O6 — CID 25054664
5-O-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butyl] 3-O-methyl 2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate;hydrochloride (PubChem CID 25054664) has the molecular formula C30H35Cl3N4O6 and a molecular weight of 653.99 g/mol. Its IUPAC name is 5-O-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butyl] 3-O-methyl 2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate;hydrochloride.
| Compound Name | 5-O-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butyl] 3-O-methyl 2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate;hydrochloride |
|---|---|
| PubChem CID | 25054664 |
| Molecular Formula | C30H35Cl3N4O6 |
| Molecular Weight | 653.99 g/mol |
| Exact Mass | 652.16 |
| IUPAC Name | 5-O-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butyl] 3-O-methyl 2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate;hydrochloride |
| SMILES | COC(=O)C1=C(C)NC(C)=C(C(=O)OCCCCN2CCN(c3cccc(Cl)c3Cl)CC2)C1c1cccc([N+](=O)[O-])c1.Cl |
| InChI | InChI=1S/C30H34Cl2N4O6.ClH/c1-19-25(29(37)41-3)27(21-8-6-9-22(18-21)36(39)40)26(20(2)33-19)30(38)42-17-5-4-12-34-13-15-35(16-14-34)24-11-7-10-23(31)28(24)32;/h6-11,18,27,33H,4-5,12-17H2,1-3H3;1H |
| InChIKey | PZYBVUBDLCJWIB-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 114.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 653.99 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|