C38H45N4O7P — CID 10462392
2-(4-benzhydrylpiperazin-1-yl)ethyl (4R)-5-[(4R,6R)-4,6-dimethyl-2-oxo-1,3,2λ5-dioxaphosphinan-2-yl]-2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3-carboxylate (PubChem CID 10462392) has the molecular formula C38H45N4O7P and a molecular weight of 700.77 g/mol. Its IUPAC name is 2-(4-benzhydrylpiperazin-1-yl)ethyl (4R)-5-[(4R,6R)-4,6-dimethyl-2-oxo-1,3,2λ5-dioxaphosphinan-2-yl]-2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3-carboxylate.
| Compound Name | 2-(4-benzhydrylpiperazin-1-yl)ethyl (4R)-5-[(4R,6R)-4,6-dimethyl-2-oxo-1,3,2λ5-dioxaphosphinan-2-yl]-2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3-carboxylate |
|---|---|
| PubChem CID | 10462392 |
| Molecular Formula | C38H45N4O7P |
| Molecular Weight | 700.77 g/mol |
| Exact Mass | 700.30 |
| IUPAC Name | 2-(4-benzhydrylpiperazin-1-yl)ethyl (4R)-5-[(4R,6R)-4,6-dimethyl-2-oxo-1,3,2λ5-dioxaphosphinan-2-yl]-2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3-carboxylate |
| SMILES | CC1=C(C(=O)OCCN2CCN(C(c3ccccc3)c3ccccc3)CC2)[C@@H](c2cccc([N+](=O)[O-])c2)C(P2(=O)O[C@H](C)C[C@@H](C)O2)=C(C)N1 |
| InChI | InChI=1S/C38H45N4O7P/c1-26-24-27(2)49-50(46,48-26)37-29(4)39-28(3)34(35(37)32-16-11-17-33(25-32)42(44)45)38(43)47-23-22-40-18-20-41(21-19-40)36(30-12-7-5-8-13-30)31-14-9-6-10-15-31/h5-17,25-27,35-36,39H,18-24H2,1-4H3/t26-,27-,35-/m1/s1 |
| InChIKey | SETQYEOWBPZUAW-DOBRQBTGSA-N |
| XLogP | 7.14 |
| TPSA | 123.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 700.77 |
| LogP ≤ 5 | 7.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|