C36H37F2N3O6 — CID 123429197
5-O-[1-[3,3-bis(4-fluorophenyl)propyl]-3-methylpyrrolidin-3-yl] 3-O-methyl 2,6-dimethyl-4-(3-nitrophenyl)-3,4-dihydropyridine-3,5-dicarboxylate (PubChem CID 123429197) has the molecular formula C36H37F2N3O6 and a molecular weight of 645.70 g/mol. Its IUPAC name is 5-O-[1-[3,3-bis(4-fluorophenyl)propyl]-3-methylpyrrolidin-3-yl] 3-O-methyl 2,6-dimethyl-4-(3-nitrophenyl)-3,4-dihydropyridine-3,5-dicarboxylate.
| Compound Name | 5-O-[1-[3,3-bis(4-fluorophenyl)propyl]-3-methylpyrrolidin-3-yl] 3-O-methyl 2,6-dimethyl-4-(3-nitrophenyl)-3,4-dihydropyridine-3,5-dicarboxylate |
|---|---|
| PubChem CID | 123429197 |
| Molecular Formula | C36H37F2N3O6 |
| Molecular Weight | 645.70 g/mol |
| Exact Mass | 645.27 |
| IUPAC Name | 5-O-[1-[3,3-bis(4-fluorophenyl)propyl]-3-methylpyrrolidin-3-yl] 3-O-methyl 2,6-dimethyl-4-(3-nitrophenyl)-3,4-dihydropyridine-3,5-dicarboxylate |
| SMILES | COC(=O)C1C(C)=NC(C)=C(C(=O)OC2(C)CCN(CCC(c3ccc(F)cc3)c3ccc(F)cc3)C2)C1c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C36H37F2N3O6/c1-22-31(34(42)46-4)33(26-6-5-7-29(20-26)41(44)45)32(23(2)39-22)35(43)47-36(3)17-19-40(21-36)18-16-30(24-8-12-27(37)13-9-24)25-10-14-28(38)15-11-25/h5-15,20,30-31,33H,16-19,21H2,1-4H3 |
| InChIKey | AICAFIIYMQEOTF-UHFFFAOYSA-N |
| XLogP | 6.72 |
| TPSA | 111.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 645.70 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|