C30H35N3O6 — CID 54037972
3-O-methyl 5-O-[2-(2-methylpiperidin-1-yl)-1-phenylethyl] 2,6-dimethyl-4-(3-nitrophenyl)-3,4-dihydropyridine-3,5-dicarboxylate (PubChem CID 54037972) has the molecular formula C30H35N3O6 and a molecular weight of 533.63 g/mol. Its IUPAC name is 3-O-methyl 5-O-[2-(2-methylpiperidin-1-yl)-1-phenylethyl] 2,6-dimethyl-4-(3-nitrophenyl)-3,4-dihydropyridine-3,5-dicarboxylate.
| Compound Name | 3-O-methyl 5-O-[2-(2-methylpiperidin-1-yl)-1-phenylethyl] 2,6-dimethyl-4-(3-nitrophenyl)-3,4-dihydropyridine-3,5-dicarboxylate |
|---|---|
| PubChem CID | 54037972 |
| Molecular Formula | C30H35N3O6 |
| Molecular Weight | 533.63 g/mol |
| Exact Mass | 533.25 |
| IUPAC Name | 3-O-methyl 5-O-[2-(2-methylpiperidin-1-yl)-1-phenylethyl] 2,6-dimethyl-4-(3-nitrophenyl)-3,4-dihydropyridine-3,5-dicarboxylate |
| SMILES | COC(=O)C1C(C)=NC(C)=C(C(=O)OC(CN2CCCCC2C)c2ccccc2)C1c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C30H35N3O6/c1-19-11-8-9-16-32(19)18-25(22-12-6-5-7-13-22)39-30(35)27-21(3)31-20(2)26(29(34)38-4)28(27)23-14-10-15-24(17-23)33(36)37/h5-7,10,12-15,17,19,25-26,28H,8-9,11,16,18H2,1-4H3 |
| InChIKey | LKHWNZXKOZVEPY-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 111.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.63 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|