C26H30N4O7 — CID 54365507
3-O-methyl 5-O-[1-(1,3-oxazol-2-yl)-2-piperidin-1-ylethyl] 2,6-dimethyl-4-(3-nitrophenyl)-3,4-dihydropyridine-3,5-dicarboxylate (PubChem CID 54365507) has the molecular formula C26H30N4O7 and a molecular weight of 510.55 g/mol. Its IUPAC name is 3-O-methyl 5-O-[1-(1,3-oxazol-2-yl)-2-piperidin-1-ylethyl] 2,6-dimethyl-4-(3-nitrophenyl)-3,4-dihydropyridine-3,5-dicarboxylate.
| Compound Name | 3-O-methyl 5-O-[1-(1,3-oxazol-2-yl)-2-piperidin-1-ylethyl] 2,6-dimethyl-4-(3-nitrophenyl)-3,4-dihydropyridine-3,5-dicarboxylate |
|---|---|
| PubChem CID | 54365507 |
| Molecular Formula | C26H30N4O7 |
| Molecular Weight | 510.55 g/mol |
| Exact Mass | 510.21 |
| IUPAC Name | 3-O-methyl 5-O-[1-(1,3-oxazol-2-yl)-2-piperidin-1-ylethyl] 2,6-dimethyl-4-(3-nitrophenyl)-3,4-dihydropyridine-3,5-dicarboxylate |
| SMILES | COC(=O)C1C(C)=NC(C)=C(C(=O)OC(CN2CCCCC2)c2ncco2)C1c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C26H30N4O7/c1-16-21(25(31)35-3)23(18-8-7-9-19(14-18)30(33)34)22(17(2)28-16)26(32)37-20(24-27-10-13-36-24)15-29-11-5-4-6-12-29/h7-10,13-14,20-21,23H,4-6,11-12,15H2,1-3H3 |
| InChIKey | UPMRMDSUYJFBTA-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 137.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.55 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|