C27H31N4O8+ — CID 7222391
5-O-[2-[4-(furan-2-carbonyl)piperazin-1-ium-1-yl]ethyl] 3-O-methyl (4S)-2,6-dimethyl-4-(3-nitrophenyl)-3,4-dihydropyridine-3,5-dicarboxylate (PubChem CID 7222391) has the molecular formula C27H31N4O8+ and a molecular weight of 539.57 g/mol. Its IUPAC name is 5-O-[2-[4-(furan-2-carbonyl)piperazin-1-ium-1-yl]ethyl] 3-O-methyl (4S)-2,6-dimethyl-4-(3-nitrophenyl)-3,4-dihydropyridine-3,5-dicarboxylate.
| Compound Name | 5-O-[2-[4-(furan-2-carbonyl)piperazin-1-ium-1-yl]ethyl] 3-O-methyl (4S)-2,6-dimethyl-4-(3-nitrophenyl)-3,4-dihydropyridine-3,5-dicarboxylate |
|---|---|
| PubChem CID | 7222391 |
| Molecular Formula | C27H31N4O8+ |
| Molecular Weight | 539.57 g/mol |
| Exact Mass | 539.21 |
| IUPAC Name | 5-O-[2-[4-(furan-2-carbonyl)piperazin-1-ium-1-yl]ethyl] 3-O-methyl (4S)-2,6-dimethyl-4-(3-nitrophenyl)-3,4-dihydropyridine-3,5-dicarboxylate |
| SMILES | COC(=O)C1C(C)=NC(C)=C(C(=O)OCC[NH+]2CCN(C(=O)c3ccco3)CC2)[C@@H]1c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C27H30N4O8/c1-17-22(26(33)37-3)24(19-6-4-7-20(16-19)31(35)36)23(18(2)28-17)27(34)39-15-13-29-9-11-30(12-10-29)25(32)21-8-5-14-38-21/h4-8,14,16,22,24H,9-13,15H2,1-3H3/p+1/t22?,24-/m1/s1 |
| InChIKey | ZSDVNRAZSQFOKU-SYIFMXBLSA-O |
| XLogP | 1.39 |
| TPSA | 145.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.57 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|