C24H23N3O5 — CID 12818461
methyl 7-benzyl-2-methyl-4-(3-nitrophenyl)-5-oxo-1,4,6,8-tetrahydro-1,7-naphthyridine-3-carboxylate (PubChem CID 12818461) has the molecular formula C24H23N3O5 and a molecular weight of 433.46 g/mol. Its IUPAC name is methyl 7-benzyl-2-methyl-4-(3-nitrophenyl)-5-oxo-1,4,6,8-tetrahydro-1,7-naphthyridine-3-carboxylate.
| Compound Name | methyl 7-benzyl-2-methyl-4-(3-nitrophenyl)-5-oxo-1,4,6,8-tetrahydro-1,7-naphthyridine-3-carboxylate |
|---|---|
| PubChem CID | 12818461 |
| Molecular Formula | C24H23N3O5 |
| Molecular Weight | 433.46 g/mol |
| Exact Mass | 433.16 |
| IUPAC Name | methyl 7-benzyl-2-methyl-4-(3-nitrophenyl)-5-oxo-1,4,6,8-tetrahydro-1,7-naphthyridine-3-carboxylate |
| SMILES | COC(=O)C1=C(C)NC2=C(C(=O)CN(Cc3ccccc3)C2)C1c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C24H23N3O5/c1-15-21(24(29)32-2)22(17-9-6-10-18(11-17)27(30)31)23-19(25-15)13-26(14-20(23)28)12-16-7-4-3-5-8-16/h3-11,22,25H,12-14H2,1-2H3 |
| InChIKey | HZCPZPVBOOTEAT-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 101.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.46 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|