C34H45N3O4 — CID 11168962
bis(3-cyclopentylpropyl) 2,6-dimethyl-4-(2-phenyl-1H-imidazol-5-yl)-1,4-dihydropyridine-3,5-dicarboxylate (PubChem CID 11168962) has the molecular formula C34H45N3O4 and a molecular weight of 559.75 g/mol. Its IUPAC name is bis(3-cyclopentylpropyl) 2,6-dimethyl-4-(2-phenyl-1H-imidazol-5-yl)-1,4-dihydropyridine-3,5-dicarboxylate.
| Compound Name | bis(3-cyclopentylpropyl) 2,6-dimethyl-4-(2-phenyl-1H-imidazol-5-yl)-1,4-dihydropyridine-3,5-dicarboxylate |
|---|---|
| PubChem CID | 11168962 |
| Molecular Formula | C34H45N3O4 |
| Molecular Weight | 559.75 g/mol |
| Exact Mass | 559.34 |
| IUPAC Name | bis(3-cyclopentylpropyl) 2,6-dimethyl-4-(2-phenyl-1H-imidazol-5-yl)-1,4-dihydropyridine-3,5-dicarboxylate |
| SMILES | CC1=C(C(=O)OCCCC2CCCC2)C(c2cnc(-c3ccccc3)[nH]2)C(C(=O)OCCCC2CCCC2)=C(C)N1 |
| InChI | InChI=1S/C34H45N3O4/c1-23-29(33(38)40-20-10-16-25-12-6-7-13-25)31(28-22-35-32(37-28)27-18-4-3-5-19-27)30(24(2)36-23)34(39)41-21-11-17-26-14-8-9-15-26/h3-5,18-19,22,25-26,31,36H,6-17,20-21H2,1-2H3,(H,35,37) |
| InChIKey | LOQQKBKIFYFDQL-UHFFFAOYSA-N |
| XLogP | 7.34 |
| TPSA | 93.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.75 |
| LogP ≤ 5 | 7.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|