C23H30N2O3 — CID 11280516
2-(pyridine-3-carbonylamino)butyl 2-[4-(2-methylpropyl)phenyl]propanoate (PubChem CID 11280516) has the molecular formula C23H30N2O3 and a molecular weight of 382.50 g/mol. Its IUPAC name is 2-(pyridine-3-carbonylamino)butyl 2-[4-(2-methylpropyl)phenyl]propanoate.
| Compound Name | 2-(pyridine-3-carbonylamino)butyl 2-[4-(2-methylpropyl)phenyl]propanoate |
|---|---|
| PubChem CID | 11280516 |
| Molecular Formula | C23H30N2O3 |
| Molecular Weight | 382.50 g/mol |
| Exact Mass | 382.23 |
| IUPAC Name | 2-(pyridine-3-carbonylamino)butyl 2-[4-(2-methylpropyl)phenyl]propanoate |
| SMILES | CCC(COC(=O)C(C)c1ccc(CC(C)C)cc1)NC(=O)c1cccnc1 |
| InChI | InChI=1S/C23H30N2O3/c1-5-21(25-22(26)20-7-6-12-24-14-20)15-28-23(27)17(4)19-10-8-18(9-11-19)13-16(2)3/h6-12,14,16-17,21H,5,13,15H2,1-4H3,(H,25,26) |
| InChIKey | SJOHIXPERVTTIZ-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.50 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |